InCHi String:
InChI=1/C48H52O16/c1-27(49)57-19-9-10-31-11-15-39(41(20-31)53-5)63-45(26-58-28(2)50)48(34-14-17-38(62-30(4)52)43(23-34)55-7)64-40-18-13-33(22-44(40)56-8)47-36-25-59-46(35(36)24-60-47)32-12-16-37(61-29(3)51)42(21-32)54-6/h9-18,20-23,35-36,45-48H,19,24-26H2,1-8H3/b10-9+/t35-,36-,45+,46+,47+,48-/m1/s1
Canonical and Isomeric SMILES: CC(=O)OCC=CC1=CC(=C(C=C1)O[C@@H](COC(C)=O)[C@@H](C2=CC(=C(C=C2)OC(C)=O)OC)OC3=C(C=C(C=C3)[C@H]6[C@@H]5CO[C@@H](C4=CC(=C(C=C4)OC(C)=O)OC)[C@@H]5CO6)OC)OC
BeilsteinGuaiacylglycerol-A-pinoresinol-B-coniferyl-bis-ether (Ac?d)
PubChem Substance (SID): n/a
PubChem Compound (CID): n/a
KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component n/a
NMR Lignin Database 2059
Miscellaneous Databases and IDs: n/a
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
