InCHi String:
InChI=1/C20H22O6/c1-25-17-11-13(5-3-7-21)9-15(19(17)23)16-10-14(6-4-8-22)12-18(26-2)20(16)24/h3-6,9-12,21-24H,7-8H2,1-2H3/b5-3+,6-4+
Canonical and Isomeric SMILES: COC1=CC(=CC(=C1O)C2=C(C(=CC(=C2)C=CCO)OC)O)C=CCO
Beilstein5,5 Dehydrodiconiferyl Alcohol
PubChem Substance (SID): n/a
PubChem Compound (CID): n/a
KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component n/a
NMR Lignin Database 2058
Miscellaneous Databases and IDs: n/a
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
