InCHi String:
InChI=1/C20H18O8/c1-27-15-6-9(3-4-13(15)21)17-11-8-14(22)16(28-2)7-10(11)5-12(19(23)24)18(17)20(25)26/h3-8,17-18,21-22H,1-2H3,(H,23,24)(H,25,26)/t17-,18-/m0/s1/f/h23,25H
Canonical and Isomeric SMILES: COC1=C(C=CC(=C1)[C@H]2C3=C(C=C([C@@H]2C(O)=O)C(O)=O)C=C(C(=C3)O)OC)O
BeilsteinB-B-coupled dehydrodiferulic acid
PubChem Substance (SID): n/a
PubChem Compound (CID): n/a
KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component n/a
NMR Lignin Database 2036
Miscellaneous Databases and IDs: n/a
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.