InCHi String:
InChI=1/C20H18O8/c1-27-17-9-11(3-5-15(17)21)7-13(19(23)24)14(20(25)26)8-12-4-6-16(22)18(10-12)28-2/h3-10,21-22H,1-2H3,(H,23,24)(H,25,26)/b13-7+,14-8+/f/h23,25H
Canonical and Isomeric SMILES: COC1=C(C=CC(=C1)C=C(C(=CC2=CC(=C(C=C2)O)OC)C(O)=O)C(O)=O)O
Beilstein4,4?-dihydroxy-3,3?-dimethoxy-B,B?-bicinnamic acid
PubChem Substance (SID): n/a
PubChem Compound (CID): n/a
KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component n/a
NMR Lignin Database 2031
Miscellaneous Databases and IDs: n/a
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
