InCHi String:
InChI=1/C14H16O6/c1-9(15)20-14-11(17-2)7-10(8-12(14)18-3)5-6-13(16)19-4/h5-8H,1-4H3/b6-5+
Canonical and Isomeric SMILES: CC(=O)OC1=C(C=C(C=CC(=O)OC)C=C1OC)OC
BeilsteinAcetylated Sinapic acid methyl ester
PubChem Substance (SID): n/a
PubChem Compound (CID): n/a
KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component n/a
NMR Lignin Database 196
Miscellaneous Databases and IDs: n/a
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
