InCHi String:
InChI=1S/C15H14O3/c1-9(2)7-8-12-13(16)10-5-3-4-6-11(10)14(17)15(12)18/h3-7,16H,8H2,1-2H3
canonical and isomeric SMILES: CC(=CCC1=C(C2=CC=CC=C2C(=O)C1=O)O)C
PUBCHEM iupac NAME: PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac CAS NAME4-hydroxy-3-(3-methylbut-2-enyl)naphthalene-1,2-dione
PUBCHEM iupac TRADITIONAL NAME4-hydroxy-3-(3-methylbut-2-enyl)-1,2-naphthoquinone
PUBCHEM iupac SYSTEMATIC NAME3-(3-methylbut-2-enyl)-4-oxidanyl-naphthalene-1,2-dione
PubChem Substance (SID):
144080990 24848565 12552PubChem Compound (CID):
3884KEGG: Compound ID
C10366CAS Registry IDs: 84-79-7
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
CAS 84-79-7
MMCD cq_07034
Sigma-Aldrich 142905_ALDRICH
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.