InCHi String:
InChI=1S/C12H18O3/c1-2-3-4-5-10-9(8-12(14)15)6-7-11(10)13/h3-4,9-10H,2,5-8H2,1H3,(H,14,15)/b4-3-/t9-,10-/m1/s1
canonical SMILES: CCC=CCC1C(CCC1=O)CC(=O)O
isomeric SMILES: CC\C=C/C[C@@H]1[C@H](CCC1=O)CC(=O)O
PUBCHEM iupac NAME: PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac CAS NAME2-[(1R,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetic acid
PUBCHEM iupac TRADITIONAL NAME2-[(1R,2R)-3-keto-2-[(Z)-pent-2-enyl]cyclopentyl]acetic acid
PUBCHEM iupac SYSTEMATIC NAME2-[(1R,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]ethanoic acid
PubChem Substance (SID):
85165306 39290070 11113268PubChem Compound (CID):
5281166KEGG: Compound ID
C08491CAS Registry IDs: 6894-38-8
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich J2500_SIGMA
ChEBI CHEBI:18292 ChemIDplus 006894388
ChemSpider 4444606
NCGC NCGC00017349-01
MMCD cq_05177
MDL MFCD0017441
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
