InCHi String:
InChI=1S/C5H6O4/c1-3(5(8)9)2-4(6)7/h1-2H2,(H,6,7)(H,8,9)
isomeric and canonical SMILES: C=C(CC(=O)O)C(=O)O
IUPAC: IUPAC systematic2-methylidenebutanedioic acid
IUPAC traditional2-methylenesuccinic acid
IUPAC cas: IUPAC openeye2-methylenebutanedioic acid
PubChem Substance (SID):
85164966 150407 3773PubChem Compound (CID):
811KEGG: Compound ID
C00490CAS Registry IDs: 50976-31-3 5363-69-9 97-65-4
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
CHEBI 30838 HSDB 5308
EINECS 202-599-6
NSC 3357
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
