InCHi String:
InChI=1S/C6H5NO2/c8-6(9)5-1-3-7-4-2-5/h1-4H,(H,8,9)
isomeric and canonical SMILES: C1=CN=CC=C1C(=O)O
IUPAC: IUPAC systematicpyridine-4-carboxylic acid
IUPAC traditional: IUPAC cas: IUPAC openeyeisonicotinic acid
PubChem Substance (SID):
85164964 148737 9649PubChem Compound (CID):
5922KEGG: Compound ID
C07446CAS Registry IDs: 55-22-1
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
CHEBI 6032 EINECS 200-228-2
NSC 1483
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
