InCHi String:
InChI=1S/C11H9NO3/c13-10(11(14)15)5-7-6-12-9-4-2-1-3-8(7)9/h1-4,6,12H,5H2,(H,14,15)
canonical and isomeric SMILES: C1=CC=C2C(=C1)C(=CN2)CC(=O)C(=O)O
PUBCHEM iupac NAME: PUBCHEM iupac CAS NAME3-(1H-indol-3-yl)-2-oxopropanoic acid
PUBCHEM iupac TRADITIONAL NAME3-(1H-indol-3-yl)-2-keto-propionic acid
PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac SYSTEMATIC NAME3-(1H-indol-3-yl)-2-oxo-propanoic acid
PubChem Substance (SID):
111677785 24896073 3625PubChem Compound (CID):
803KEGG: Compound ID
C00331CAS Registry IDs: 35656-49-6
PDB Chemical Component
3IOMiscellaneous Databases and IDs:
Sigma-Aldrich I5567_ALDRICH
ChEBI CHEBI:29750 MMDB 38473.5
NIST 238832541
MMCD cq_00243
MDL MFCD00005640
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.