InCHi String:
InChI=1S/C10H9NO2/c12-10(13)5-7-6-11-9-4-2-1-3-8(7)9/h1-4,6,11H,5H2,(H,12,13)
isomeric and canonical SMILES: C1=CC=C2C(=C1)C(=CN2)CC(=O)O
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye2-(1H-indol-3-yl)acetic acid
IUPAC systematic2-(1H-indol-3-yl)ethanoic acid
PubChem Substance (SID):
85165000 149893 4205PubChem Compound (CID):
802KEGG: Compound ID
C00954CAS Registry IDs: 2338-19-4 54692-39-6 6305-45-9 87-51-4
PDB Chemical Component
IACMiscellaneous Databases and IDs:
CHEBI 16411 EINECS 201-748-2
CCRIS 1014
NSC 3787
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
