InCHi String:
InChI=1S/C8H7N/c1-2-4-8-7(3-1)5-6-9-8/h1-6,9H
isomeric and canonical SMILES: C1=CC=C2C(=C1)C=CN2
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye: IUPAC systematic1H-indole
PubChem Substance (SID):
85164936 151597 3747PubChem Compound (CID):
798KEGG: Compound ID
C00463CAS Registry IDs: 120-72-9
PDB Chemical Component
INDMiscellaneous Databases and IDs:
CHEBI 16881 HSDB 599
NSC 1964
CCRIS 4421
EINECS 204-420-7
FEMA No. 2593
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
