InCHi String:
InChI=1S/C10H12O4/c1-13-8-4-3-7(6-10(11)12)5-9(8)14-2/h3-5H,6H2,1-2H3,(H,11,12)
canonical and isomeric SMILES: COC1=C(C=C(C=C1)CC(=O)O)OC
PUBCHEM iupac NAME: PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac CAS NAME2-(3,4-dimethoxyphenyl)acetic acid
PUBCHEM iupac TRADITIONAL NAMEhomoveratric acid
PUBCHEM iupac SYSTEMATIC NAME2-(3,4-dimethoxyphenyl)ethanoic acid
PubChem Substance (SID):
111677820 10538284 8001692PubChem Compound (CID):
7139KEGG: Compound ID n/a
CAS Registry IDs: 93-40-3
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich 53650_FLUKA
ChemBank ChemDiv3_014360
NMRShiftDB 20040369
ChemDB 5164160
NIST Chemistry WebBook 3655105971
MMCD cq_10616
MDL MFCD00004335
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
