Wikipedia:  

Homovanillic acid

Vanillacetic acid; HMPA; 4-Hydroxy-3-methoxyphenylacetic acid; Benzeneacetic acid, 4-hydroxy-3-methoxy-; (4-HYDROXY-3-METHOXYPHENYL)ACETIC ACID; 4-Hydroxy-3-methoxybenzeneacetic acid; HVA; Homovanillate; 3-Methoxy-4-hydroxyphenylacetic acid; Acetic acid, (4-hydroxy-3-methoxyphenyl)- (8CI); Homovanillic acid
Molecular Formula
C9 H10 O4
Natural Isotopic Abundance Mass
182.1733000000
Mono-Isotopic Molecular Masses
C12N14:   182.057908809
C13N14:   191.08810235
C12N15:   182.057908809
C13N15:   191.08810235
Homovanillic acid image
Homovanillic acid
InCHi String:
InChI=1S/C9H10O4/c1-13-8-4-6(5-9(11)12)2-3-7(8)10/h2-4,10H,5H2,1H3,(H,11,12)

isomeric and canonical SMILES:
COC1=C(C=CC(=C1)CC(=O)O)O


IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye
2-(4-hydroxy-3-methoxy-phenyl)acetic acid

IUPAC systematic
2-(4-hydroxy-3-methoxy-phenyl)ethanoic acid



PubChem Substance (SID):   85164963   152580   7908
PubChem Compound (CID):   1738
KEGG: Compound ID   C05582
CAS Registry IDs:   306-08-1
PDB Chemical Component   n/a
Miscellaneous Databases and IDs:   EINECS 206-176-7   NSC 16682

Reference data were obtained primarily from the PubChem database.

Three dimensional molecular rendering uses Jmol.