InCHi String:
InChI=1S/C7H16N4O2/c8-5(6(12)13)3-1-2-4-11-7(9)10/h5H,1-4,8H2,(H,12,13)(H4,9,10,11)/t5-/m0/s1
canonical SMILES: C(CCN=C(N)N)CC(C(=O)O)N
isomeric SMILES: C(CCN=C(N)N)C[C@@H](C(=O)O)N
PUBCHEM iupac NAME(2S)-2-amino-6-(diaminomethylideneamino)hexanoic acid
PUBCHEM iupac TRADITIONAL NAME: PUBCHEM iupac OPENEYE NAME(2S)-2-amino-6-guanidino-hexanoic acid
PUBCHEM iupac CAS NAME(2S)-2-amino-6-guanidinohexanoic acid
PUBCHEM iupac SYSTEMATIC NAME(2S)-2-azanyl-6-[bis(azanyl)methylideneamino]hexanoic acid
PubChem Substance (SID):
111677876 152276 5030PubChem Compound (CID):
9085KEGG: Compound ID
C01924CAS Registry IDs: 156-86-5 13094-78-5
PDB Chemical Component
HRGMiscellaneous Databases and IDs:
CAS 156-86-5
MMCD cq_01229
ChemIDplus 000156865
NIST 760275665
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.