InCHi String:
InChI=1S/C2H4O3/c3-1-2(4)5/h3H,1H2,(H,4,5)
isomeric and canonical SMILES: C(C(=O)O)O
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye2-hydroxyacetic acid
IUPAC systematic2-hydroxyethanoic acid
PubChem Substance (SID):
85165053 149551 3460PubChem Compound (CID):
757KEGG: Compound ID
C00160CAS Registry IDs: 1932-50-9 25904-89-6 2836-32-0 35249-89-9 39663-84-8 79-14-1
PDB Chemical Component
GOAMiscellaneous Databases and IDs:
CHEBI 29805 NSC 166
EINECS 201-180-5
Beilstein Handbook Reference 4-03-00-00571
HSDB 5227
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.