InCHi String:
InChI=1S/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13)/t2-,3-,4+,5-/m1/s1
isomeric SMILES: C([C@H]([C@H]([C@@H]([C@H](C(=O)O)O)O)O)O)O
canonical SMILES: C(C(C(C(C(C(=O)O)O)O)O)O)O
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye: IUPAC systematic(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid
PubChem Substance (SID):
85164927 153991 3556PubChem Compound (CID):
10690KEGG: Compound ID
C00257CAS Registry IDs: 10101-21-0 10361-31-6 13005-35-1 14906-97-9 22830-45-1 299-27-4 35087-77-5 35984-19-1 3632-91-5 526-95-4 527-07-1 60007-93-4 60816-70-8 6485-39-8 82139-35-3
PDB Chemical Component
GCOMiscellaneous Databases and IDs:
CHEBI 4157 EINECS 208-401-4
Beilstein Handbook Reference 4-03-00-01255
HSDB 487
NSC 77381
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.