InCHi String:
InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,7-8H,5-6H2,1-3H3
canonical and isomeric SMILES: CC1=CCC(=CC1)C(C)C
PUBCHEM iupac NAME: PUBCHEM iupac CAS NAME1-methyl-4-propan-2-ylcyclohexa-1,4-diene
PUBCHEM iupac TRADITIONAL NAME: PUBCHEM iupac OPENEYE NAME1-isopropyl-4-methyl-cyclohexa-1,4-diene
PUBCHEM iupac SYSTEMATIC NAME1-methyl-4-propan-2-yl-cyclohexa-1,4-diene
PubChem Substance (SID):
111677903 24888685 12086PubChem Compound (CID):
7461KEGG: Compound ID
C09900CAS Registry IDs: 99-85-4
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
CAS 99-85-4
MMCD cq_06569
Sigma-Aldrich 86478_FLUKA
NIST Chemistry WebBook 1468281627
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.