InCHi String:
InChI=1S/C6H10O3/c1-3-9-6(8)4-5(2)7/h3-4H2,1-2H3
canonical and isomeric SMILES: CCOC(=O)CC(=O)C
PUBCHEM iupac NAME: PUBCHEM iupac OPENEYE NAMEethyl 3-oxobutanoate
PUBCHEM iupac TRADITIONAL NAME3-ketobutyric acid ethyl ester
PUBCHEM iupac CAS NAME3-oxobutanoic acid ethyl ester
PUBCHEM iupac SYSTEMATIC NAMEethyl 3-oxidanylidenebutanoate
PubChem Substance (SID):
144080945 71953094 48417489PubChem Compound (CID):
8868KEGG: Compound ID
C03500CAS Registry IDs: 141-97-9
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
CAS 20412-62-8
MMCD cq_02089
MDL number MFCD00044220
Sigma-Aldrich 164100_ALDRICH
EPA DSSTox 27093
ZINC ZINC05650471
ChEMBL CHEMBL169176
ChemSpider 13865426
NMRShiftDB 10016867
NIST 2817390235
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.