InCHi String:
InChI=1S/C10H14O3/c1-13-10-7-8(3-2-6-11)4-5-9(10)12/h4-5,7,11-12H,2-3,6H2,1H3
canonical and isomeric SMILES: COC1=C(C=CC(=C1)CCCO)O
PUBCHEM iupac NAME: PUBCHEM iupac CAS NAME4-(3-hydroxypropyl)-2-methoxyphenol
PUBCHEM iupac TRADITIONAL NAME: PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac SYSTEMATIC NAME4-(3-hydroxypropyl)-2-methoxy-phenol
PubChem Substance (SID):
85165361 12631 10514500PubChem Compound (CID):
16822KEGG: Compound ID
C10448CAS Registry IDs: 2305-13-7
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
ChemDB 4950341
NIST Chemistry WebBook 2287996778
MMCD cq_07113
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
