InCHi String:
InChI=1S/C8H12O5/c1-3-12-7(10)5-6(9)8(11)13-4-2/h3-5H2,1-2H3
isomeric and canonical SMILES: CCOC(=O)CC(=O)C(=O)OCC
IUPAC: IUPAC cas: IUPAC openeye: IUPAC systematicdiethyl 2-oxobutanedioate
IUPAC traditional2-oxosuccinic acid diethyl ester
PubChem Substance (SID):
85164977 209052PubChem Compound (CID):
66951KEGG: Compound ID n/a
CAS Registry IDs: 108-56-5
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
EINECS 203-594-1
NSC 68476
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
