InCHi String:
InChI=1S/C5H7NO2/c7-5(8)4-2-1-3-6-4/h1-2,4,6H,3H2,(H,7,8)
isomeric and canonical SMILES: C1C=CC(N1)C(=O)O
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye: IUPAC systematic2,5-dihydro-1H-pyrrole-2-carboxylic acid
PubChem Substance (SID):
85164925 680495PubChem Compound (CID):
97858KEGG: Compound ID n/a
CAS Registry IDs: 3395-35-5
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
EINECS 222-243-3
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.