bmse000250 dAMP at BMRB

InCHi String:
InChI=1S/C10H14N5O6P/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(16)6(21-7)2-20-22(17,18)19/h3-7,16H,1-2H2,(H2,11,12,13)(H2,17,18,19)/t5-,6+,7+/m0/s1

canonical SMILES:
C1C(C(OC1N2C=NC3=C2N=CN=C3N)COP(=O)(O)O)O

IUPAC: IUPAC systematic
[(2S,3R,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-oxolan-2-yl]methoxyphosphonic acid

IUPAC traditional: IUPAC cas: IUPAC openeye
[(2S,3R,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-tetrahydrofuran-2-yl]methoxyphosphonic acid

PubChem Substance (SID):   85165057   155929   3651
PubChem Compound (CID):   12599
KEGG: Compound ID   C00360
CAS Registry IDs:   653-63-4   75688-15-2   87578-08-3   29576-96-3   2922-74-9
PDB Chemical Component   A3A   D5M   DA
Miscellaneous Databases and IDs:   ChemIDplus 000653634   EINECS 211-503-1

Reference data were obtained primarily from the PubChem database.

Three dimensional molecular rendering uses Jmol.