InCHi String:
InChI=1S/C4H7N3O/c1-7-2-3(8)6-4(7)5/h2H2,1H3,(H2,5,6,8)
isomeric and canonical SMILES: CN1CC(=O)N=C1N
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye: IUPAC systematic2-amino-1-methyl-5H-imidazol-4-one
PubChem Substance (SID):
85164981 148940 4049PubChem Compound (CID):
588KEGG: Compound ID
C00791CAS Registry IDs: 15231-31-9 45514-66-7 60-27-5 82016-55-5
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
CHEBI 16737 EINECS 200-466-7
NSC 13123
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.