InCHi String:
InChI=1S/C4H10N3O5P/c1-7(2-3(8)9)4(5)6-13(10,11)12/h2H2,1H3,(H,8,9)(H4,5,6,10,11,12)
isomeric and canonical SMILES: CN(CC(=O)O)C(=NP(=O)(O)O)N
IUPAC: IUPAC traditional: IUPAC openeye2-[methyl-(N'-phosphonocarbamimidoyl)amino]acetic acid
IUPAC cas2-[(amino-phosphonoimino-methyl)-methyl-amino]acetic acid
IUPAC systematic2-[methyl-(N'-phosphonocarbamimidoyl)amino]ethanoic acid
PubChem Substance (SID):
111677719 149112 5359PubChem Compound (CID):
587KEGG: Compound ID
C02305CAS Registry IDs: 67-07-2 922-32-7
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
CHEBI 17287 EINECS 200-643-9
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.