InCHi String:
InChI=1S/C4H9N3O2/c1-7(4(5)6)2-3(8)9/h2H2,1H3,(H3,5,6)(H,8,9)
isomeric and canonical SMILES: CN(CC(=O)O)C(=N)N
IUPAC2-(carbamimidoyl-methyl-amino)acetic acid
IUPAC traditional: IUPAC cas: IUPAC openeye2-(amidino-methyl-amino)acetic acid
IUPAC systematic2-(carbamimidoyl-methyl-amino)ethanoic acid
PubChem Substance (SID):
85164924 148804 3594PubChem Compound (CID):
586KEGG: Compound ID
C00300CAS Registry IDs: 57-00-1
PDB Chemical Component
CRNMiscellaneous Databases and IDs:
CHEBI 16919 EINECS 200-306-6
NSC 8752
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
