InCHi String:
InChI=1S/C5H6O4/c1-3(5(8)9)2-4(6)7/h2H,1H3,(H,6,7)(H,8,9)/b3-2-
isomeric and canonical SMILES: CC(=CC(=O)O)C(=O)O
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye: IUPAC systematic2-methylbut-2-enedioic acid
PubChem Substance (SID):
85165017 153624 5291PubChem Compound (CID):
874KEGG: Compound ID
C02226CAS Registry IDs: 498-23-7
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
CHEBI 30719 EINECS 207-858-7
Beilstein Handbook Reference 4-02-00-02230
NSC 32949
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
