InCHi String:
InChI=1S/C20H30O6/c1-3-5-11-23-13-15-25-19(21)17-9-7-8-10-18(17)20(22)26-16-14-24-12-6-4-2/h7-10H,3-6,11-16H2,1-2H3
canonical and isomeric SMILES: CCCCOCCOC(=O)C1=CC=CC=C1C(=O)OCCOCCCC
PUBCHEM iupac NAME: PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac SYSTEMATIC NAMEbis(2-butoxyethyl) benzene-1,2-dicarboxylate
PUBCHEM iupac TRADITIONAL NAME: PUBCHEM iupac CAS NAMEbenzene-1,2-dicarboxylic acid bis(2-butoxyethyl) ester
PubChem Substance (SID):
111677865 17396435 24869646PubChem Compound (CID):
8345KEGG: Compound ID
C15438CAS Registry IDs: 117-83-9
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich 460095_ALDRICH
ChemDB 6687439
NIST Chemistry WebBook 2107655270
MMCD cq_17072
CAS 117-83-9
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.