InCHi String:
InChI=1S/C11H12O4/c12-10(13)7-9(11(14)15)6-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,12,13)(H,14,15)
canonical and isomeric SMILES: C1=CC=C(C=C1)CC(CC(=O)O)C(=O)O
PUBCHEM iupac NAME: PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac CAS NAME2-benzylbutanedioic acid
PUBCHEM iupac TRADITIONAL NAME2-benzylsuccinic acid
PUBCHEM iupac SYSTEMATIC NAME2-(phenylmethyl)butanedioic acid
PubChem Substance (SID):
10537435 24892039 17439402PubChem Compound (CID):
3858KEGG: Compound ID n/a
CAS Registry IDs: 884-33-3
PDB Chemical Component
BZSMiscellaneous Databases and IDs:
Sigma-Aldrich B8011_SIGMA
ChEBI CHEBI:16054 PDSP nsc20708
NIST Chemistry WebBook 4014780189
NIST 4014780189
MMCD cq_06487
MDL MFCD00055798
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.