InCHi String:
InChI=1S/C7H7NO2/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,8H2,(H,9,10)
isomeric and canonical SMILES: C1=CC=C(C(=C1)C(=O)O)N
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye: IUPAC systematic2-aminobenzoic acid
PubChem Substance (SID):
85164913 151521 3408PubChem Compound (CID):
227KEGG: Compound ID
C00108CAS Registry IDs: 118-92-3 14342-65-5 2099-63-0 552-37-4 60613-06-1 7058-55-1 7459-95-2 80206-34-4
PDB Chemical Component
6AB BE2Miscellaneous Databases and IDs:
CHEBI 30754 CCRIS 49
HSDB 1321
EINECS 204-287-5
NSC 144
Beilstein Handbook Reference 4-27-00-07875
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
