InCHi String:
InChI=1S/C11H8O2/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,(H,12,13)
isomeric and canonical SMILES: C1=CC=C2C(=C1)C=CC=C2C(=O)O
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye: IUPAC systematicnaphthalene-1-carboxylic acid
PubChem Substance (SID):
85165001 149851 854327PubChem Compound (CID):
6847KEGG: Compound ID
C14091CAS Registry IDs: 86-55-5
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
NSC 37569
EINECS 201-681-9
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
