InCHi String:
InChI=1S/C8H15NOS2/c9-8(10)4-2-1-3-7-5-6-11-12-7/h7H,1-6H2,(H2,9,10)
canonical and isomeric SMILES: C1CSSC1CCCCC(=O)N
PUBCHEM iupac NAME: PUBCHEM iupac OPENEYE NAME5-(dithiolan-3-yl)pentanamide
PUBCHEM iupac TRADITIONAL NAME5-(dithiolan-3-yl)valeramide
PUBCHEM iupac CAS NAME5-(3-dithiolanyl)pentanamide
PUBCHEM iupac SYSTEMATIC NAME5-(1,2-dithiolan-3-yl)pentanamide
PubChem Substance (SID):
111677894 3547 87691489PubChem Compound (CID):
863KEGG: Compound ID
C00248CAS Registry IDs: 940-69-2
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
CAS 940-69-2
MMCD cq_00180
NMRShiftDB 20200153
LipidMAPS LMFA08010006
NIST Chemistry WebBook 2398303641
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.