InCHi String:
InChI=1S/C5H6O5/c6-3(5(9)10)1-2-4(7)8/h1-2H2,(H,7,8)(H,9,10)
isomeric and canonical SMILES: C(CC(=O)O)C(=O)C(=O)O
IUPAC: IUPAC cas: IUPAC openeye: IUPAC systematic2-oxopentanedioic acid
IUPAC traditional2-oxoglutaric acid
PubChem Substance (SID):
85164910 152694 3328PubChem Compound (CID):
51KEGG: Compound ID
C00026CAS Registry IDs: 15303-07-8 17091-15-5 22202-68-2 27175-99-1 305-72-6 328-50-7 86248-59-1 997-43-3
PDB Chemical Component
2OG AKGMiscellaneous Databases and IDs:
CHEBI 30915 EINECS 206-330-3
NSC 17391
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.