InCHi String:
InChI=1S/C5H14N4/c6-3-1-2-4-9-5(7)8/h1-4,6H2,(H4,7,8,9)
isomeric and canonical SMILES: C(CCN=C(N)N)CN
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye: IUPAC systematic2-(4-aminobutyl)guanidine
PubChem Substance (SID):
85164909 152592 3479PubChem Compound (CID):
199KEGG: Compound ID
C00179CAS Registry IDs: 306-60-5
PDB Chemical Component
AG2Miscellaneous Databases and IDs:
CHEBI 17431 EINECS 206-187-7
NSC 56332
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
