InCHi String:
InChI=1S/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4+,5?
isomeric and canonical SMILES: C(C(C(C(CO)O)O)O)O
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye: IUPAC systematicpentane-1,2,3,4,5-pentol
PubChem Substance (SID):
111677718 841607 153529PubChem Compound (CID):
827KEGG: Compound ID
C00474CAS Registry IDs: 28296-13-1 488-81-3 84709-28-4
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
CHEBI 15963 EINECS 207-685-7
Beilstein Handbook Reference 4-01-00-02832
NSC 16868
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.