InCHi String:
InChI=1S/C5H5N5/c6-4-3-5(9-1-7-3)10-2-8-4/h1-2H,(H3,6,7,8,9,10)
isomeric and canonical SMILES: C1=NC2=C(N1)C(=NC=N2)N
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye: IUPAC systematic7H-purin-6-amine
PubChem Substance (SID):
85164907 149245 3447PubChem Compound (CID):
190KEGG: Compound ID
C00147CAS Registry IDs: 22051-90-7 42911-33-1 42911-34-2 520-75-2 73-24-5
PDB Chemical Component
ADE ANEMiscellaneous Databases and IDs:
CHEBI 16708 CCRIS 2556
NSC 14666
EINECS 200-796-1
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.