InCHi String:
InChI=1S/C9H10O3/c1-6(10)7-3-4-8(11)9(5-7)12-2/h3-5,11H,1-2H3
canonical and isomeric SMILES: CC(=O)C1=CC(=C(C=C1)O)OC
PUBCHEM iupac NAME: PUBCHEM iupac CAS NAME1-(4-hydroxy-3-methoxyphenyl)ethanone
PUBCHEM iupac TRADITIONAL NAME: PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac SYSTEMATIC NAME1-(4-hydroxy-3-methoxy-phenyl)ethanone
PubChem Substance (SID):
85165360 37204904 955525PubChem Compound (CID):
2214KEGG: Compound ID
C11380CAS Registry IDs: 498-02-2
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich W508454_ALDRICH
ChEBI CHEBI:2781 ChemSpider 10538201
ZINC ZINC00162515
NIST Chemistry WebBook 3489687771
MMCD cq_08019
MDL MFCD00008747
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
