InCHi String:
InChI=1/C9H10O4/c1-12-8-5-6(9(11)13-2)3-4-7(8)10/h3-5,10H,1-2H3
Canonical and Isomeric SMILES: COC1=C(C=CC(=C1)C(=O)OC)O
BeilsteinVanillic acid methyl ester
PubChem Substance (SID):
111678062PubChem Compound (CID): n/a
KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component
VXXNMR Lignin Database 65
Miscellaneous Databases and IDs: n/a
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
