InCHi String:
InChI=1/C25H28O8/c1-15(26)31-10-6-7-17-11-19-20(14-32-16(2)27)24(33-25(19)23(12-17)30-5)18-8-9-21(28-3)22(13-18)29-4/h6-9,11-13,20,24H,10,14H2,1-5H3/b7-6+
Canonical and Isomeric SMILES: CC(=O)OCC=CC1=CC3=C(C(=C1)OC)OC(C2=CC(=C(C=C2)OC)OC)C3COC(C)=O
Lignin abbreviationV-c-CA
PubChem Substance (SID):
111678016PubChem Compound (CID): n/a
KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component n/a
NMR Lignin Database 221
Miscellaneous Databases and IDs: n/a
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.