InCHi String:
InChI=1S/C9H10O3/c10-6-8(9(11)12)7-4-2-1-3-5-7/h1-5,8,10H,6H2,(H,11,12)
canonical and isomeric SMILES: C1=CC=C(C=C1)C(CO)C(=O)O
PUBCHEM iupac NAME: PUBCHEM iupac CAS NAME3-hydroxy-2-phenylpropanoic acid
PUBCHEM iupac TRADITIONAL NAME3-hydroxy-2-phenyl-propionic acid
PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac SYSTEMATIC NAME3-hydroxy-2-phenyl-propanoic acid
PubChem Substance (SID):
85165205 213289 11533260PubChem Compound (CID):
10726KEGG: Compound ID
C01456CAS Registry IDs: 529-64-6 552-63-6 28845-94-5
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich T89206_ALDRICH
ChEBI CHEBI:30765 ChemIDplus 000552636
ChemSpider 10274
EINECS 208-465-3
CambridgeSoft Corporation 9937
NIST Chemistry WebBook 444981734
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
