InCHi String:
InChI=1/C10H12O5/c1-13-7-4-6(10(12)15-3)5-8(14-2)9(7)11/h4-5,11H,1-3H3
Canonical and Isomeric SMILES: COC1=C(C(=CC(=C1)C(=O)OC)OC)O
BeilsteinSyringic acid methyl ester
PubChem Substance (SID):
111678061PubChem Compound (CID): n/a
KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component
SYRNMR Lignin Database 64
Miscellaneous Databases and IDs: n/a
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
