InCHi String:
InChI=1/C20H20O6/c1-24-17-12-15(13-18(25-2)20(17)23)4-3-11-26-19(22)10-7-14-5-8-16(21)9-6-14/h3-10,12-13,21,23H,11H2,1-2H3/b4-3+,10-7+
Canonical and Isomeric SMILES: COC1=C(C(=CC(=C1)C=CCOC(C=CC2=CC=C(C=C2)O)=O)OC)O
BeilsteinSinapyl p-coumarate
PubChem Substance (SID):
111678081PubChem Compound (CID): n/a
KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component n/a
NMR Lignin Database 2065
Miscellaneous Databases and IDs: n/a
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
