InCHi String:
InChI=1/C15H18O6/c1-10(16)20-7-5-6-12-8-13(18-3)15(21-11(2)17)14(9-12)19-4/h5-6,8-9H,7H2,1-4H3/b6-5+
Canonical and Isomeric SMILES: CC(=O)OCC=CC1=CC(=C(C(=C1)OC)OC(C)=O)OC
BeilsteinSinapyl alcohol diacetate
PubChem Substance (SID):
111678011PubChem Compound (CID): n/a
KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component n/a
NMR Lignin Database 211
Miscellaneous Databases and IDs: n/a
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
