InCHi String:
InChI=1S/C5H11NO2Se/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)
canonical SMILES: C[Se]CCC(C(=O)O)N
IUPAC: IUPAC openeye: IUPAC systematic2-amino-4-methylselanyl-butanoic acid
IUPAC traditional: IUPAC cas2-amino-4-methylseleno-butanoic acid
PubChem Substance (SID):
85165095 158422 7713PubChem Compound (CID):
15103KEGG: Compound ID
C05335CAS Registry IDs: 1464-42-2 2578-28-1
PDB Chemical Component
MSEMiscellaneous Databases and IDs:
ChemIDplus 001464422
EINECS 215-977-0
CCRIS 3970
HSDB 3564
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
