InCHi String:
InChI=1/C27H30O10/c1-15(28)34-9-7-8-18-10-20-21(14-35-16(2)29)25(37-26(20)22(11-18)31-4)19-12-23(32-5)27(36-17(3)30)24(13-19)33-6/h7-8,10-13,21,25H,9,14H2,1-6H3/b8-7+
Canonical and Isomeric SMILES: CC(=O)OCC=CC1=CC3=C(C(=C1)OC)OC(C2=CC(=C(C(=C2)OC)OC(C)=O)OC)C3COC(C)=O
Lignin abbreviationS-c-CA (acetate)
PubChem Substance (SID):
111677996PubChem Compound (CID): n/a
KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component n/a
NMR Lignin Database 187
Miscellaneous Databases and IDs: n/a
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.