InCHi String:
InChI=1/C26H30O12/c1-14(28)35-13-23(38-26-19(31-4)8-17(12-27)9-20(26)32-5)24(36-15(2)29)18-10-21(33-6)25(37-16(3)30)22(11-18)34-7/h8-12,23-24H,13H2,1-7H3
Canonical and Isomeric SMILES: CC(=O)OCC(C(C1=CC(=C(C(=C1)OC)OC(C)=O)OC)OC(C)=O)OC2=C(C=C(C=C2OC)C=O)OC
Lignin abbreviationS-b-S
PubChem Substance (SID):
111678022PubChem Compound (CID): n/a
KEGG: Compound ID n/a
CAS Registry IDs: n/a
PDB Chemical Component n/a
NMR Lignin Database 228 229
Miscellaneous Databases and IDs: n/a
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.