InCHi String:
InChI=1S/C10H14O/c1-7(2)9-5-4-8(3)10(11)6-9/h4,9H,1,5-6H2,2-3H3/t9-/m1/s1
canonical SMILES: CC1=CCC(CC1=O)C(=C)C
isomeric SMILES: CC1=CC[C@H](CC1=O)C(=C)C
PUBCHEM iupac NAME(5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one
PUBCHEM iupac TRADITIONAL NAME: PUBCHEM iupac OPENEYE NAME(5R)-5-isopropenyl-2-methyl-cyclohex-2-en-1-one
PUBCHEM iupac CAS NAME(5R)-5-isopropenyl-2-methyl-1-cyclohex-2-enone
PUBCHEM iupac SYSTEMATIC NAME(5R)-2-methyl-5-prop-1-en-2-yl-cyclohex-2-en-1-one
PubChem Substance (SID):
85165282 24847635 1492208PubChem Compound (CID):
439570KEGG: Compound ID
C01767CAS Registry IDs: 99-49-0 6485-40-1
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich 124931_ALDRICH
LipidMAPS LMPR01020026
ZINC ZINC00967795
ChemSpider 388655
NMRShiftDB 10008722
MMCD cq_01139
MDL MFCD00001578
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.