InCHi String:
InChI=1S/C6H10O3/c1-6(2)3-9-5(8)4(6)7/h4,7H,3H2,1-2H3/t4-/m0/s1
canonical SMILES: CC1(COC(=O)C1O)C
isomeric SMILES: CC1(COC(=O)[C@@H]1O)C
PUBCHEM iupac NAME(3R)-3-hydroxy-4,4-dimethyloxolan-2-one
PUBCHEM iupac TRADITIONAL NAME: PUBCHEM iupac OPENEYE NAME(3R)-3-hydroxy-4,4-dimethyl-tetrahydrofuran-2-one
PUBCHEM iupac CAS NAME(3R)-3-hydroxy-4,4-dimethyl-2-tetrahydrofuranone
PUBCHEM iupac SYSTEMATIC NAME(3R)-3-hydroxy-4,4-dimethyl-oxolan-2-one
PubChem Substance (SID):
85165175 24854272 36883602PubChem Compound (CID):
439368KEGG: Compound ID
C01012CAS Registry IDs: 599-04-2
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich 237817_ALDRICH
ChemSpider 388488
NMRShiftDB 20055544
ZINC ZINC00155364
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.