InCHi String:
InChI=1S/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6)/t2-/m1/s1
canonical SMILES: CC(C(=O)O)O
IUPAC: IUPAC systematic(2S)-2-hydroxypropanoic acid
IUPAC traditional: IUPAC openeye: IUPAC caslactic acid
PubChem Substance (SID):
85165074 197769 3555PubChem Compound (CID):
61503KEGG: Compound ID
C00256CAS Registry IDs: 10326-41-7
PDB Chemical Component
DLA LACMiscellaneous Databases and IDs:
ChemIDplus 010326417
EINECS 233-713-2
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
