InCHi String:
InChI=1S/C5H7NO3/c7-4-2-1-3(6-4)5(8)9/h3H,1-2H2,(H,6,7)(H,8,9)/t3-/m1/s1
canonical SMILES: C1CC(=O)NC1C(=O)O
isomeric SMILES: C1CC(=O)N[C@H]1C(=O)O
PUBCHEM iupac NAME: PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac SYSTEMATIC NAME(2R)-5-oxopyrrolidine-2-carboxylic acid
PUBCHEM iupac TRADITIONAL NAMEpyroglutamic acid
PUBCHEM iupac CAS NAME(2R)-5-oxo-2-pyrrolidinecarboxylic acid
PubChem Substance (SID):
85165268 5301 8143592PubChem Compound (CID):
439685KEGG: Compound ID
C02237CAS Registry IDs: 4042-36-8
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich 422614_ALDRICH
ChEBI CHEBI:16924 ChemSpider 388752
MMCD cq_01415
MDL MFCD00066212
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.